C9H19N — CID 134223979
N-ethenyl-N,2-dimethylpentan-3-amine (PubChem CID 134223979) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is N-ethenyl-N,2-dimethylpentan-3-amine.
| Compound Name | N-ethenyl-N,2-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 134223979 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | N-ethenyl-N,2-dimethylpentan-3-amine |
| SMILES | C=CN(C)C(CC)C(C)C |
| InChI | InChI=1S/C9H19N/c1-6-9(8(3)4)10(5)7-2/h7-9H,2,6H2,1,3-5H3 |
| InChIKey | VXBPDWGAFHZUSA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |