C16H33NO4 — CID 123355857
2-tert-butyl-3-(dimethylamino)-6-(hydroxymethyl)-5-[(2-methylpropan-2-yl)oxy]oxan-4-ol (PubChem CID 123355857) has the molecular formula C16H33NO4 and a molecular weight of 303.44 g/mol. Its IUPAC name is 2-tert-butyl-3-(dimethylamino)-6-(hydroxymethyl)-5-[(2-methylpropan-2-yl)oxy]oxan-4-ol.
| Compound Name | 2-tert-butyl-3-(dimethylamino)-6-(hydroxymethyl)-5-[(2-methylpropan-2-yl)oxy]oxan-4-ol |
|---|---|
| PubChem CID | 123355857 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 2-tert-butyl-3-(dimethylamino)-6-(hydroxymethyl)-5-[(2-methylpropan-2-yl)oxy]oxan-4-ol |
| SMILES | CN(C)C1C(O)C(OC(C)(C)C)C(CO)OC1C(C)(C)C |
| InChI | InChI=1S/C16H33NO4/c1-15(2,3)14-11(17(7)8)12(19)13(10(9-18)20-14)21-16(4,5)6/h10-14,18-19H,9H2,1-8H3 |
| InChIKey | QOFPMXZKRFQMCC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |