C10H18I2O5 — CID 129254497
[2-tert-butyl-4-hydroxy-6-(hydroxymethyl)-5-iodooxyoxan-3-yl] hypoiodite (PubChem CID 129254497) has the molecular formula C10H18I2O5 and a molecular weight of 472.06 g/mol. Its IUPAC name is [2-tert-butyl-4-hydroxy-6-(hydroxymethyl)-5-iodooxyoxan-3-yl] hypoiodite.
| Compound Name | [2-tert-butyl-4-hydroxy-6-(hydroxymethyl)-5-iodooxyoxan-3-yl] hypoiodite |
|---|---|
| PubChem CID | 129254497 |
| Molecular Formula | C10H18I2O5 |
| Molecular Weight | 472.06 g/mol |
| Exact Mass | 471.92 |
| IUPAC Name | [2-tert-butyl-4-hydroxy-6-(hydroxymethyl)-5-iodooxyoxan-3-yl] hypoiodite |
| SMILES | CC(C)(C)C1OC(CO)C(OI)C(O)C1OI |
| InChI | InChI=1S/C10H18I2O5/c1-10(2,3)9-8(17-12)6(14)7(16-11)5(4-13)15-9/h5-9,13-14H,4H2,1-3H3 |
| InChIKey | GRRIGFZHYDFXFM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.06 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|