C10H20O4S — CID 70675474
(2R,3R,4R,6S)-2-(hydroxymethyl)-6-[(2-methylpropan-2-yl)oxy]-4-sulfanyloxan-3-ol (PubChem CID 70675474) has the molecular formula C10H20O4S and a molecular weight of 236.33 g/mol. Its IUPAC name is (2R,3R,4R,6S)-2-(hydroxymethyl)-6-[(2-methylpropan-2-yl)oxy]-4-sulfanyloxan-3-ol.
| Compound Name | (2R,3R,4R,6S)-2-(hydroxymethyl)-6-[(2-methylpropan-2-yl)oxy]-4-sulfanyloxan-3-ol |
|---|---|
| PubChem CID | 70675474 |
| Molecular Formula | C10H20O4S |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (2R,3R,4R,6S)-2-(hydroxymethyl)-6-[(2-methylpropan-2-yl)oxy]-4-sulfanyloxan-3-ol |
| SMILES | CC(C)(C)O[C@H]1C[C@@H](S)[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C10H20O4S/c1-10(2,3)14-8-4-7(15)9(12)6(5-11)13-8/h6-9,11-12,15H,4-5H2,1-3H3/t6-,7-,8+,9-/m1/s1 |
| InChIKey | PUDWDSZYVFRJSA-LURQLKTLSA-N |
| XLogP | 0.57 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|