C9H18O6S — CID 87182324
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(2-sulfanylpropan-2-yloxy)oxane-3,4,5-triol (PubChem CID 87182324) has the molecular formula C9H18O6S and a molecular weight of 254.30 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(2-sulfanylpropan-2-yloxy)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(2-sulfanylpropan-2-yloxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 87182324 |
| Molecular Formula | C9H18O6S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(2-sulfanylpropan-2-yloxy)oxane-3,4,5-triol |
| SMILES | CC(C)(S)O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H18O6S/c1-9(2,16)15-8-7(13)6(12)5(11)4(3-10)14-8/h4-8,10-13,16H,3H2,1-2H3/t4-,5+,6+,7-,8-/m1/s1 |
| InChIKey | MPLQECSXGYIVRD-DWOUCZDBSA-N |
| XLogP | -1.53 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|