C9H13N — CID 123356016
5-ethyl-3-azabicyclo[5.1.0]octa-2,4-diene (PubChem CID 123356016) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 5-ethyl-3-azabicyclo[5.1.0]octa-2,4-diene.
| Compound Name | 5-ethyl-3-azabicyclo[5.1.0]octa-2,4-diene |
|---|---|
| PubChem CID | 123356016 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 5-ethyl-3-azabicyclo[5.1.0]octa-2,4-diene |
| SMILES | CCC1=CN=CC2CC2C1 |
| InChI | InChI=1S/C9H13N/c1-2-7-3-8-4-9(8)6-10-5-7/h5-6,8-9H,2-4H2,1H3 |
| InChIKey | YXQVAXUREIIWHN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |