C10H19NO6 — CID 123356072
2-[(3,5,6-trihydroxy-2,4-dimethylhexylidene)amino]oxyacetic acid (PubChem CID 123356072) has the molecular formula C10H19NO6 and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-[(3,5,6-trihydroxy-2,4-dimethylhexylidene)amino]oxyacetic acid.
| Compound Name | 2-[(3,5,6-trihydroxy-2,4-dimethylhexylidene)amino]oxyacetic acid |
|---|---|
| PubChem CID | 123356072 |
| Molecular Formula | C10H19NO6 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-[(3,5,6-trihydroxy-2,4-dimethylhexylidene)amino]oxyacetic acid |
| SMILES | CC(C=NOCC(=O)O)C(O)C(C)C(O)CO |
| InChI | InChI=1S/C10H19NO6/c1-6(3-11-17-5-9(14)15)10(16)7(2)8(13)4-12/h3,6-8,10,12-13,16H,4-5H2,1-2H3,(H,14,15) |
| InChIKey | YCQGMZURCRRUQG-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|