C16H29NO7 — CID 172937779
4-ethyl-1-[(Z)-(3,4,5,6-tetrahydroxy-2-methylhexylidene)amino]oxyheptane-2,5-dione (PubChem CID 172937779) has the molecular formula C16H29NO7 and a molecular weight of 347.41 g/mol. Its IUPAC name is 4-ethyl-1-[(Z)-(3,4,5,6-tetrahydroxy-2-methylhexylidene)amino]oxyheptane-2,5-dione.
| Compound Name | 4-ethyl-1-[(Z)-(3,4,5,6-tetrahydroxy-2-methylhexylidene)amino]oxyheptane-2,5-dione |
|---|---|
| PubChem CID | 172937779 |
| Molecular Formula | C16H29NO7 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 4-ethyl-1-[(Z)-(3,4,5,6-tetrahydroxy-2-methylhexylidene)amino]oxyheptane-2,5-dione |
| SMILES | CCC(=O)C(CC)CC(=O)CO/N=C\C(C)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C16H29NO7/c1-4-11(13(20)5-2)6-12(19)9-24-17-7-10(3)15(22)16(23)14(21)8-18/h7,10-11,14-16,18,21-23H,4-6,8-9H2,1-3H3/b17-7- |
| InChIKey | UUWAHJNONDLPJM-IDUWFGFVSA-N |
| XLogP | -0.34 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|