C10H14N+ — CID 123356199
2,3-dimethyl-1-penta-2,4-dien-2-ylazet-1-ium (PubChem CID 123356199) has the molecular formula C10H14N+ and a molecular weight of 148.23 g/mol. Its IUPAC name is 2,3-dimethyl-1-penta-2,4-dien-2-ylazet-1-ium.
| Compound Name | 2,3-dimethyl-1-penta-2,4-dien-2-ylazet-1-ium |
|---|---|
| PubChem CID | 123356199 |
| Molecular Formula | C10H14N+ |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 2,3-dimethyl-1-penta-2,4-dien-2-ylazet-1-ium |
| SMILES | C=CC=C(C)[N+]1=C(C)C(C)=C1 |
| InChI | InChI=1S/C10H14N/c1-5-6-9(3)11-7-8(2)10(11)4/h5-7H,1H2,2-4H3/q+1 |
| InChIKey | RHAZHEBBZCBWIS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|