C10H17N2+ — CID 123356613
ethyl-methylidene-[2-(methylideneamino)hexa-2,4-dien-3-yl]azanium (PubChem CID 123356613) has the molecular formula C10H17N2+ and a molecular weight of 165.26 g/mol. Its IUPAC name is ethyl-methylidene-[2-(methylideneamino)hexa-2,4-dien-3-yl]azanium.
| Compound Name | ethyl-methylidene-[2-(methylideneamino)hexa-2,4-dien-3-yl]azanium |
|---|---|
| PubChem CID | 123356613 |
| Molecular Formula | C10H17N2+ |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.14 |
| IUPAC Name | ethyl-methylidene-[2-(methylideneamino)hexa-2,4-dien-3-yl]azanium |
| SMILES | C=NC(C)=C(C=CC)[N+](=C)CC |
| InChI | InChI=1S/C10H17N2/c1-6-8-10(9(3)11-4)12(5)7-2/h6,8H,4-5,7H2,1-3H3/q+1 |
| InChIKey | GQKOIGNQRSPRBG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|