C22H23ClN4O4S2 — CID 123357557
5-(5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl)-4-chloro-N-[[3-(1,2-oxazol-3-yl)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 123357557) has the molecular formula C22H23ClN4O4S2 and a molecular weight of 507.04 g/mol. Its IUPAC name is 5-(5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl)-4-chloro-N-[[3-(1,2-oxazol-3-yl)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-(5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl)-4-chloro-N-[[3-(1,2-oxazol-3-yl)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 123357557 |
| Molecular Formula | C22H23ClN4O4S2 |
| Molecular Weight | 507.04 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 5-(5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl)-4-chloro-N-[[3-(1,2-oxazol-3-yl)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | CC1(c2sc(C(=O)NCc3cccc(-c4ccon4)c3)cc2Cl)CS(=O)(=O)C(C)(C)C(N)=N1 |
| InChI | InChI=1S/C22H23ClN4O4S2/c1-21(2)20(24)26-22(3,12-33(21,29)30)18-15(23)10-17(32-18)19(28)25-11-13-5-4-6-14(9-13)16-7-8-31-27-16/h4-10H,11-12H2,1-3H3,(H2,24,26)(H,25,28) |
| InChIKey | AIFGVTQYFBWVGF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.04 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |