About (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate
(2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate (PubChem CID 123358837) has the molecular formula C17H17NO8S2
and a molecular weight of 427.46 g/mol. Its IUPAC name is (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate.
Molecular Properties
| Compound Name | (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate |
| PubChem CID | 123358837 |
| Molecular Formula | C17H17NO8S2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate |
| SMILES | CS(=O)(=O)c1ccccc1S(=O)(=O)NC(=O)OOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C17H17NO8S2/c1-27(21,22)14-9-5-6-10-15(14)28(23,24)18-17(20)26-25-16(19)12-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3,(H,18,20) |
| InChIKey | LXXXRYXYQVAGOB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate?
The IUPAC name of (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate (CID 123358837) is (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate.
What is the SMILES notation for (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate?
The canonical SMILES for (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate is CS(=O)(=O)c1ccccc1S(=O)(=O)NC(=O)OOC(=O)CCc1ccccc1.
What is the InChIKey of (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate?
The InChIKey is LXXXRYXYQVAGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO8S2/c1-27(21,22)14-9-5-6-10-15(14)28(23,24)18-17(20)26-25-16(19)12-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3,(H,18,20).
What are the key properties of (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate?
(2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate has a molecular weight of 427.46 g/mol, XLogP of 1.60, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylsulfonylphenyl)sulfonylcarbamoyl 3-phenylpropaneperoxoate is sourced from PubChem (CID 123358837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).