C19H17ClN4 — CID 123359457
2-(3-chloro-5,6-diphenyl-2H-1,2,4-triazin-5-yl)-2-methylpropanenitrile (PubChem CID 123359457) has the molecular formula C19H17ClN4 and a molecular weight of 336.83 g/mol. Its IUPAC name is 2-(3-chloro-5,6-diphenyl-2H-1,2,4-triazin-5-yl)-2-methylpropanenitrile.
| Compound Name | 2-(3-chloro-5,6-diphenyl-2H-1,2,4-triazin-5-yl)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 123359457 |
| Molecular Formula | C19H17ClN4 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-(3-chloro-5,6-diphenyl-2H-1,2,4-triazin-5-yl)-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)C1(c2ccccc2)N=C(Cl)NN=C1c1ccccc1 |
| InChI | InChI=1S/C19H17ClN4/c1-18(2,13-21)19(15-11-7-4-8-12-15)16(23-24-17(20)22-19)14-9-5-3-6-10-14/h3-12H,1-2H3,(H,22,24) |
| InChIKey | ZVARVMDTBDSFIB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 60.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|