C16H17N5 — CID 71236552
5-(4-methylphenyl)-6-phenyl-2H-1,2,4-triazine-3,5-diamine (PubChem CID 71236552) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 5-(4-methylphenyl)-6-phenyl-2H-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-(4-methylphenyl)-6-phenyl-2H-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 71236552 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 5-(4-methylphenyl)-6-phenyl-2H-1,2,4-triazine-3,5-diamine |
| SMILES | Cc1ccc(C2(N)N=C(N)NN=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17N5/c1-11-7-9-13(10-8-11)16(18)14(20-21-15(17)19-16)12-5-3-2-4-6-12/h2-10H,18H2,1H3,(H3,17,19,21) |
| InChIKey | FSOANZWRQKHYSF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |