C23H34O6 — CID 123359784
(17-acetyloxy-4-methoxy-13-methyl-16-oxo-2,3,4,5,6,7,8,9,10,11,12,14,15,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate (PubChem CID 123359784) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is (17-acetyloxy-4-methoxy-13-methyl-16-oxo-2,3,4,5,6,7,8,9,10,11,12,14,15,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate.
| Compound Name | (17-acetyloxy-4-methoxy-13-methyl-16-oxo-2,3,4,5,6,7,8,9,10,11,12,14,15,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 123359784 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (17-acetyloxy-4-methoxy-13-methyl-16-oxo-2,3,4,5,6,7,8,9,10,11,12,14,15,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate |
| SMILES | COC1C(OC(C)=O)CCC2C3CCC4(C)C(OC(C)=O)C(=O)CC4C3CCC21 |
| InChI | InChI=1S/C23H34O6/c1-12(24)28-20-8-7-14-15-9-10-23(3)18(11-19(26)22(23)29-13(2)25)16(15)5-6-17(14)21(20)27-4/h14-18,20-22H,5-11H2,1-4H3 |
| InChIKey | IWTSDGFIGQATKU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |