C15H20ClN5 — CID 123361652
2-[3-(6-chlorohexa-2,4-dien-2-yl)-5-methyl-1,2,4-triazol-4-yl]-1-methyl-2,6-dihydropyridin-3-imine (PubChem CID 123361652) has the molecular formula C15H20ClN5 and a molecular weight of 305.81 g/mol. Its IUPAC name is 2-[3-(6-chlorohexa-2,4-dien-2-yl)-5-methyl-1,2,4-triazol-4-yl]-1-methyl-2,6-dihydropyridin-3-imine.
| Compound Name | 2-[3-(6-chlorohexa-2,4-dien-2-yl)-5-methyl-1,2,4-triazol-4-yl]-1-methyl-2,6-dihydropyridin-3-imine |
|---|---|
| PubChem CID | 123361652 |
| Molecular Formula | C15H20ClN5 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[3-(6-chlorohexa-2,4-dien-2-yl)-5-methyl-1,2,4-triazol-4-yl]-1-methyl-2,6-dihydropyridin-3-imine |
| SMILES | [H]/N=C1\C=CCN(C)C1n1c(C)nnc1C(C)=CC=CCCl |
| InChI | InChI=1S/C15H20ClN5/c1-11(7-4-5-9-16)14-19-18-12(2)21(14)15-13(17)8-6-10-20(15)3/h4-8,15,17H,9-10H2,1-3H3/b5-4?,11-7?,17-13+ |
| InChIKey | KWVJAOLBHKMFKU-XICHTHBWSA-N |
| XLogP | 2.80 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|