C14H21ClN4 — CID 142949150
2-chloro-5-(4-ethyl-5-pentyl-1,2,4-triazol-3-yl)-1,2-dihydropyridine (PubChem CID 142949150) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-chloro-5-(4-ethyl-5-pentyl-1,2,4-triazol-3-yl)-1,2-dihydropyridine.
| Compound Name | 2-chloro-5-(4-ethyl-5-pentyl-1,2,4-triazol-3-yl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 142949150 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-chloro-5-(4-ethyl-5-pentyl-1,2,4-triazol-3-yl)-1,2-dihydropyridine |
| SMILES | CCCCCc1nnc(C2=CNC(Cl)C=C2)n1CC |
| InChI | InChI=1S/C14H21ClN4/c1-3-5-6-7-13-17-18-14(19(13)4-2)11-8-9-12(15)16-10-11/h8-10,12,16H,3-7H2,1-2H3 |
| InChIKey | UPVCBVHXVJRIEP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|