C14H12 — CID 123362882
[(E)-2-cyclohexa-2,3,5-trien-1-ylethenyl]benzene (PubChem CID 123362882) has the molecular formula C14H12 and a molecular weight of 180.25 g/mol. Its IUPAC name is [(E)-2-cyclohexa-2,3,5-trien-1-ylethenyl]benzene.
| Compound Name | [(E)-2-cyclohexa-2,3,5-trien-1-ylethenyl]benzene |
|---|---|
| PubChem CID | 123362882 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | [(E)-2-cyclohexa-2,3,5-trien-1-ylethenyl]benzene |
| SMILES | C1=CC=CC(/C=C/c2ccccc2)C=1 |
| InChI | InChI=1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-5,7-12,14H/b12-11+ |
| InChIKey | SEMUVICYLXENOO-VAWYXSNFSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |