C19H22ClN3O — CID 123363999
1-(4-chlorophenyl)-3-(oxan-4-yl)-2,3,7,8-tetrahydropyrazolo[4,3-b]azocine (PubChem CID 123363999) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(oxan-4-yl)-2,3,7,8-tetrahydropyrazolo[4,3-b]azocine.
| Compound Name | 1-(4-chlorophenyl)-3-(oxan-4-yl)-2,3,7,8-tetrahydropyrazolo[4,3-b]azocine |
|---|---|
| PubChem CID | 123363999 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(oxan-4-yl)-2,3,7,8-tetrahydropyrazolo[4,3-b]azocine |
| SMILES | Clc1ccc(N2NC(C3CCOCC3)/C3=N/C=CCCC=C32)cc1 |
| InChI | InChI=1S/C19H22ClN3O/c20-15-5-7-16(8-6-15)23-17-4-2-1-3-11-21-19(17)18(22-23)14-9-12-24-13-10-14/h3-8,11,14,18,22H,1-2,9-10,12-13H2/b11-3?,17-4?,21-19+ |
| InChIKey | SLKGRTUXYAFCQH-PQSCRQAZSA-N |
| XLogP | 4.09 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |