C20H21ClN2O — CID 123849705
1-(4-chlorophenyl)-3-(oxan-4-yl)-7,8-dihydropyrrolo[3,2-b]azocine (PubChem CID 123849705) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(oxan-4-yl)-7,8-dihydropyrrolo[3,2-b]azocine.
| Compound Name | 1-(4-chlorophenyl)-3-(oxan-4-yl)-7,8-dihydropyrrolo[3,2-b]azocine |
|---|---|
| PubChem CID | 123849705 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(oxan-4-yl)-7,8-dihydropyrrolo[3,2-b]azocine |
| SMILES | Clc1ccc(-n2cc(C3CCOCC3)/c3c2=CCCC=C/N=3)cc1 |
| InChI | InChI=1S/C20H21ClN2O/c21-16-5-7-17(8-6-16)23-14-18(15-9-12-24-13-10-15)20-19(23)4-2-1-3-11-22-20/h3-8,11,14-15H,1-2,9-10,12-13H2/b11-3?,19-4?,22-20- |
| InChIKey | OZUPUDWOACGASN-KWYQOYIKSA-N |
| XLogP | 3.73 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |