C20H20ClNO — CID 123336149
1-(4-chlorophenyl)-3-(oxan-4-yl)-7H-cyclohepta[b]pyrrole (PubChem CID 123336149) has the molecular formula C20H20ClNO and a molecular weight of 325.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(oxan-4-yl)-7H-cyclohepta[b]pyrrole.
| Compound Name | 1-(4-chlorophenyl)-3-(oxan-4-yl)-7H-cyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 123336149 |
| Molecular Formula | C20H20ClNO |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(oxan-4-yl)-7H-cyclohepta[b]pyrrole |
| SMILES | Clc1ccc(-n2cc(C3CCOCC3)c3c2=CCC=CC=3)cc1 |
| InChI | InChI=1S/C20H20ClNO/c21-16-6-8-17(9-7-16)22-14-19(15-10-12-23-13-11-15)18-4-2-1-3-5-20(18)22/h1-2,4-9,14-15H,3,10-13H2 |
| InChIKey | RPYSUWQQTSNUIQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |