C22H20N6S2 — CID 123364311
[[[4-[(Z)-N-(carbamothioylamino)-C-phenylcarbonimidoyl]phenyl]-phenylmethylidene]amino]thiourea (PubChem CID 123364311) has the molecular formula C22H20N6S2 and a molecular weight of 432.58 g/mol. Its IUPAC name is [[[4-[(Z)-N-(carbamothioylamino)-C-phenylcarbonimidoyl]phenyl]-phenylmethylidene]amino]thiourea.
| Compound Name | [[[4-[(Z)-N-(carbamothioylamino)-C-phenylcarbonimidoyl]phenyl]-phenylmethylidene]amino]thiourea |
|---|---|
| PubChem CID | 123364311 |
| Molecular Formula | C22H20N6S2 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [[[4-[(Z)-N-(carbamothioylamino)-C-phenylcarbonimidoyl]phenyl]-phenylmethylidene]amino]thiourea |
| SMILES | NC(=S)NN=C(c1ccccc1)c1ccc(/C(=N\NC(N)=S)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N6S2/c23-21(29)27-25-19(15-7-3-1-4-8-15)17-11-13-18(14-12-17)20(26-28-22(24)30)16-9-5-2-6-10-16/h1-14H,(H3,23,27,29)(H3,24,28,30)/b25-19-,26-20? |
| InChIKey | FYMGJRJMKVSNBE-VCGWOGLGSA-N |
| XLogP | 2.86 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|