C45H69NO4S4Si — CID 123367134
8-(3-methoxy-2-methylpropoxy)octyl 6-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-methylthieno[3,4-d][1,3]thiazole-2-carboxylate (PubChem CID 123367134) has the molecular formula C45H69NO4S4Si and a molecular weight of 844.40 g/mol. Its IUPAC name is 8-(3-methoxy-2-methylpropoxy)octyl 6-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-methylthieno[3,4-d][1,3]thiazole-2-carboxylate.
| Compound Name | 8-(3-methoxy-2-methylpropoxy)octyl 6-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-methylthieno[3,4-d][1,3]thiazole-2-carboxylate |
|---|---|
| PubChem CID | 123367134 |
| Molecular Formula | C45H69NO4S4Si |
| Molecular Weight | 844.40 g/mol |
| Exact Mass | 843.39 |
| IUPAC Name | 8-(3-methoxy-2-methylpropoxy)octyl 6-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-methylthieno[3,4-d][1,3]thiazole-2-carboxylate |
| SMILES | CCCCC(CC)C[Si]1(CC(CC)CCCC)c2cc(C)sc2-c2sc(-c3sc(C)c4nc(C(=O)OCCCCCCCCOCC(C)COC)sc34)cc21 |
| InChI | InChI=1S/C45H69NO4S4Si/c1-9-13-21-34(11-3)29-55(30-35(12-4)22-14-10-2)37-25-32(6)51-41(37)42-38(55)26-36(53-42)40-43-39(33(7)52-40)46-44(54-43)45(47)50-24-20-18-16-15-17-19-23-49-28-31(5)27-48-8/h25-26,31,34-35H,9-24,27-30H2,1-8H3 |
| InChIKey | JSPVEJMDVLSQSG-UHFFFAOYSA-N |
| XLogP | 13.54 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.40 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|