C46H71NO3S4Si — CID 123464170
8-(2-methylpentoxy)octyl 6-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-methylthieno[3,4-d][1,3]thiazole-2-carboxylate (PubChem CID 123464170) has the molecular formula C46H71NO3S4Si and a molecular weight of 842.43 g/mol. Its IUPAC name is 8-(2-methylpentoxy)octyl 6-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-methylthieno[3,4-d][1,3]thiazole-2-carboxylate.
| Compound Name | 8-(2-methylpentoxy)octyl 6-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-methylthieno[3,4-d][1,3]thiazole-2-carboxylate |
|---|---|
| PubChem CID | 123464170 |
| Molecular Formula | C46H71NO3S4Si |
| Molecular Weight | 842.43 g/mol |
| Exact Mass | 841.41 |
| IUPAC Name | 8-(2-methylpentoxy)octyl 6-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-methylthieno[3,4-d][1,3]thiazole-2-carboxylate |
| SMILES | CCCCC(CC)C[Si]1(CC(CC)CCCC)c2cc(C)sc2-c2sc(-c3sc(C)c4nc(C(=O)OCCCCCCCCOCC(C)CCC)sc34)cc21 |
| InChI | InChI=1S/C46H71NO3S4Si/c1-9-14-23-35(12-4)30-55(31-36(13-5)24-15-10-2)38-27-33(7)51-42(38)43-39(55)28-37(53-43)41-44-40(34(8)52-41)47-45(54-44)46(48)50-26-21-19-17-16-18-20-25-49-29-32(6)22-11-3/h27-28,32,35-36H,9-26,29-31H2,1-8H3 |
| InChIKey | DGVWVLDZEQQDQH-UHFFFAOYSA-N |
| XLogP | 14.69 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.43 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|