C16H23ClN4O — CID 123368480
5-chloro-3-methyl-7-[3-(2-methylpropyl)piperidin-1-yl]-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 123368480) has the molecular formula C16H23ClN4O and a molecular weight of 322.84 g/mol. Its IUPAC name is 5-chloro-3-methyl-7-[3-(2-methylpropyl)piperidin-1-yl]-1H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 5-chloro-3-methyl-7-[3-(2-methylpropyl)piperidin-1-yl]-1H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 123368480 |
| Molecular Formula | C16H23ClN4O |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 5-chloro-3-methyl-7-[3-(2-methylpropyl)piperidin-1-yl]-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CC(C)CC1CCCN(c2cc(Cl)nc3c2[nH]c(=O)n3C)C1 |
| InChI | InChI=1S/C16H23ClN4O/c1-10(2)7-11-5-4-6-21(9-11)12-8-13(17)18-15-14(12)19-16(22)20(15)3/h8,10-11H,4-7,9H2,1-3H3,(H,19,22) |
| InChIKey | DQQLQVRDJLUIOA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|