About 6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane
6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane (PubChem CID 123368889) has the molecular formula C13H24
and a molecular weight of 180.33 g/mol. Its IUPAC name is 6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane.
Analyze 6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane?
The IUPAC name of 6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane (CID 123368889) is 6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane.
What is the SMILES notation for 6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane?
The canonical SMILES for 6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane is CCC1C2C(C)(C)CC(C)(C)C12C.
What is the InChIKey of 6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane?
The InChIKey is CRQQOWVSAHYFPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24/c1-7-9-10-11(2,3)8-12(4,5)13(9,10)6/h9-10H,7-8H2,1-6H3.
What are the key properties of 6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane?
6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane has a molecular weight of 180.33 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-1,2,2,4,4-pentamethylbicyclo[3.1.0]hexane is sourced from PubChem (CID 123368889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).