C11H20S — CID 135208488
(1S,2S)-2,6-diethyl-1-methylbicyclo[3.1.0]hexane-2-thiol (PubChem CID 135208488) has the molecular formula C11H20S and a molecular weight of 184.35 g/mol. Its IUPAC name is (1S,2S)-2,6-diethyl-1-methylbicyclo[3.1.0]hexane-2-thiol.
| Compound Name | (1S,2S)-2,6-diethyl-1-methylbicyclo[3.1.0]hexane-2-thiol |
|---|---|
| PubChem CID | 135208488 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (1S,2S)-2,6-diethyl-1-methylbicyclo[3.1.0]hexane-2-thiol |
| SMILES | CCC1C2CC[C@@](S)(CC)[C@@]12C |
| InChI | InChI=1S/C11H20S/c1-4-8-9-6-7-11(12,5-2)10(8,9)3/h8-9,12H,4-7H2,1-3H3/t8?,9?,10-,11-/m0/s1 |
| InChIKey | BXOBQTWYRUUQIX-TVUZUIDESA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|