C12H21N — CID 123369350
5-methyl-3,4-di(propan-2-yl)-2,3-dihydropyridine (PubChem CID 123369350) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 5-methyl-3,4-di(propan-2-yl)-2,3-dihydropyridine.
| Compound Name | 5-methyl-3,4-di(propan-2-yl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123369350 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 5-methyl-3,4-di(propan-2-yl)-2,3-dihydropyridine |
| SMILES | CC1=C(C(C)C)C(C(C)C)CN=C1 |
| InChI | InChI=1S/C12H21N/c1-8(2)11-7-13-6-10(5)12(11)9(3)4/h6,8-9,11H,7H2,1-5H3 |
| InChIKey | DAFCGVTXQXNZKU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |