C12H25O2PS2 — CID 123369599
4-heptan-2-yl-5,5-dimethyl-2-sulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane (PubChem CID 123369599) has the molecular formula C12H25O2PS2 and a molecular weight of 296.44 g/mol. Its IUPAC name is 4-heptan-2-yl-5,5-dimethyl-2-sulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane.
| Compound Name | 4-heptan-2-yl-5,5-dimethyl-2-sulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane |
|---|---|
| PubChem CID | 123369599 |
| Molecular Formula | C12H25O2PS2 |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-heptan-2-yl-5,5-dimethyl-2-sulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane |
| SMILES | CCCCCC(C)C1OP(=S)(S)OCC1(C)C |
| InChI | InChI=1S/C12H25O2PS2/c1-5-6-7-8-10(2)11-12(3,4)9-13-15(16,17)14-11/h10-11H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | BTCJRMLFBGKFLF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|