C8H16ClO2PS — CID 23413847
2-chloro-5,5-dimethyl-4-propan-2-yl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane (PubChem CID 23413847) has the molecular formula C8H16ClO2PS and a molecular weight of 242.71 g/mol. Its IUPAC name is 2-chloro-5,5-dimethyl-4-propan-2-yl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane.
| Compound Name | 2-chloro-5,5-dimethyl-4-propan-2-yl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane |
|---|---|
| PubChem CID | 23413847 |
| Molecular Formula | C8H16ClO2PS |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 2-chloro-5,5-dimethyl-4-propan-2-yl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane |
| SMILES | CC(C)C1OP(=S)(Cl)OCC1(C)C |
| InChI | InChI=1S/C8H16ClO2PS/c1-6(2)7-8(3,4)5-10-12(9,13)11-7/h6-7H,5H2,1-4H3 |
| InChIKey | ODPUKXJQQMVMMJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|