C22H26ClN5O5S — CID 123370386
N'-amino-5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-(2-morpholin-4-ylethoxy)furan-2-carboximidamide (PubChem CID 123370386) has the molecular formula C22H26ClN5O5S and a molecular weight of 508.00 g/mol. Its IUPAC name is N'-amino-5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-(2-morpholin-4-ylethoxy)furan-2-carboximidamide.
| Compound Name | N'-amino-5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-(2-morpholin-4-ylethoxy)furan-2-carboximidamide |
|---|---|
| PubChem CID | 123370386 |
| Molecular Formula | C22H26ClN5O5S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | N'-amino-5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-(2-morpholin-4-ylethoxy)furan-2-carboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc(Cl)c2-c2cc(OCCN3CCOCC3)c(C(N)=NN)o2)cc1 |
| InChI | InChI=1S/C22H26ClN5O5S/c1-15-2-4-16(5-3-15)34(29,30)28-7-6-17(23)20(28)18-14-19(21(33-18)22(24)26-25)32-13-10-27-8-11-31-12-9-27/h2-7,14H,8-13,25H2,1H3,(H2,24,26) |
| InChIKey | CUEUVSNRYLEFLT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|