C24H30ClN3O7S2 — CID 123148502
N-[3-(butylamino)propylsulfonyl]-5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-carboxamide (PubChem CID 123148502) has the molecular formula C24H30ClN3O7S2 and a molecular weight of 572.11 g/mol. Its IUPAC name is N-[3-(butylamino)propylsulfonyl]-5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-carboxamide.
| Compound Name | N-[3-(butylamino)propylsulfonyl]-5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-carboxamide |
|---|---|
| PubChem CID | 123148502 |
| Molecular Formula | C24H30ClN3O7S2 |
| Molecular Weight | 572.11 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | N-[3-(butylamino)propylsulfonyl]-5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-carboxamide |
| SMILES | CCCCNCCCS(=O)(=O)NC(=O)c1oc(-c2c(Cl)ccn2S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C24H30ClN3O7S2/c1-4-5-12-26-13-6-15-36(30,31)27-24(29)23-21(34-3)16-20(35-23)22-19(25)11-14-28(22)37(32,33)18-9-7-17(2)8-10-18/h7-11,14,16,26H,4-6,12-13,15H2,1-3H3,(H,27,29) |
| InChIKey | WASRNQPKQSOTDR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.11 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|