C17H14ClN5O4S — CID 122373537
5-[5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-yl]-2H-tetrazole (PubChem CID 122373537) has the molecular formula C17H14ClN5O4S and a molecular weight of 419.85 g/mol. Its IUPAC name is 5-[5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-yl]-2H-tetrazole.
| Compound Name | 5-[5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 122373537 |
| Molecular Formula | C17H14ClN5O4S |
| Molecular Weight | 419.85 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 5-[5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-yl]-2H-tetrazole |
| SMILES | COc1cc(-c2c(Cl)ccn2S(=O)(=O)c2ccc(C)cc2)oc1-c1nn[nH]n1 |
| InChI | InChI=1S/C17H14ClN5O4S/c1-10-3-5-11(6-4-10)28(24,25)23-8-7-12(18)15(23)13-9-14(26-2)16(27-13)17-19-21-22-20-17/h3-9H,1-2H3,(H,19,20,21,22) |
| InChIKey | CFURTZXOIAXPTI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.85 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |