C19H15ClN2O6S — CID 159371122
3-[5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-yl]-4H-1,2-oxazol-5-one (PubChem CID 159371122) has the molecular formula C19H15ClN2O6S and a molecular weight of 434.86 g/mol. Its IUPAC name is 3-[5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-yl]-4H-1,2-oxazol-5-one.
| Compound Name | 3-[5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-yl]-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 159371122 |
| Molecular Formula | C19H15ClN2O6S |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 3-[5-[3-chloro-1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-methoxyfuran-2-yl]-4H-1,2-oxazol-5-one |
| SMILES | COc1cc(-c2c(Cl)ccn2S(=O)(=O)c2ccc(C)cc2)oc1C1=NOC(=O)C1 |
| InChI | InChI=1S/C19H15ClN2O6S/c1-11-3-5-12(6-4-11)29(24,25)22-8-7-13(20)18(22)15-10-16(26-2)19(27-15)14-9-17(23)28-21-14/h3-8,10H,9H2,1-2H3 |
| InChIKey | HDJAUAHGDWQXMJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 100.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|