C23H32N2O2Si — CID 123371015
N-[1-[[3-(benzylamino)-3-oxopropyl]-methylsilyl]-3-methylbutyl]benzamide (PubChem CID 123371015) has the molecular formula C23H32N2O2Si and a molecular weight of 396.61 g/mol. Its IUPAC name is N-[1-[[3-(benzylamino)-3-oxopropyl]-methylsilyl]-3-methylbutyl]benzamide.
| Compound Name | N-[1-[[3-(benzylamino)-3-oxopropyl]-methylsilyl]-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 123371015 |
| Molecular Formula | C23H32N2O2Si |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-[1-[[3-(benzylamino)-3-oxopropyl]-methylsilyl]-3-methylbutyl]benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccccc1)[SiH](C)CCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H32N2O2Si/c1-18(2)16-22(25-23(27)20-12-8-5-9-13-20)28(3)15-14-21(26)24-17-19-10-6-4-7-11-19/h4-13,18,22,28H,14-17H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | DUIPZSGXTGLLHK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|