C8H11N — CID 123371098
6-ethenyl-2-methyl-3,4-dihydropyridine (PubChem CID 123371098) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 6-ethenyl-2-methyl-3,4-dihydropyridine.
| Compound Name | 6-ethenyl-2-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 123371098 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 6-ethenyl-2-methyl-3,4-dihydropyridine |
| SMILES | C=CC1=CCCC(C)=N1 |
| InChI | InChI=1S/C8H11N/c1-3-8-6-4-5-7(2)9-8/h3,6H,1,4-5H2,2H3 |
| InChIKey | FTJMOUIICXWPHO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |