About 5-ethenyl-6-ethyl-3,4-dihydropyridine
5-ethenyl-6-ethyl-3,4-dihydropyridine (PubChem CID 142549035) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 5-ethenyl-6-ethyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 5-ethenyl-6-ethyl-3,4-dihydropyridine |
| PubChem CID | 142549035 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 5-ethenyl-6-ethyl-3,4-dihydropyridine |
| SMILES | C=CC1=C(CC)N=CCC1 |
| InChI | InChI=1S/C9H13N/c1-3-8-6-5-7-10-9(8)4-2/h3,7H,1,4-6H2,2H3 |
| InChIKey | KJRJGUXNBNXETQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethenyl-6-ethyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-6-ethyl-3,4-dihydropyridine?
The IUPAC name of 5-ethenyl-6-ethyl-3,4-dihydropyridine (CID 142549035) is 5-ethenyl-6-ethyl-3,4-dihydropyridine.
What is the SMILES notation for 5-ethenyl-6-ethyl-3,4-dihydropyridine?
The canonical SMILES for 5-ethenyl-6-ethyl-3,4-dihydropyridine is C=CC1=C(CC)N=CCC1.
What is the InChIKey of 5-ethenyl-6-ethyl-3,4-dihydropyridine?
The InChIKey is KJRJGUXNBNXETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-3-8-6-5-7-10-9(8)4-2/h3,7H,1,4-6H2,2H3.
What are the key properties of 5-ethenyl-6-ethyl-3,4-dihydropyridine?
5-ethenyl-6-ethyl-3,4-dihydropyridine has a molecular weight of 135.21 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-6-ethyl-3,4-dihydropyridine is sourced from PubChem (CID 142549035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).