C9H13N — CID 142549035
5-ethenyl-6-ethyl-3,4-dihydropyridine (PubChem CID 142549035) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 5-ethenyl-6-ethyl-3,4-dihydropyridine.
| Compound Name | 5-ethenyl-6-ethyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 142549035 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 5-ethenyl-6-ethyl-3,4-dihydropyridine |
| SMILES | C=CC1=C(CC)N=CCC1 |
| InChI | InChI=1S/C9H13N/c1-3-8-6-5-7-10-9(8)4-2/h3,7H,1,4-6H2,2H3 |
| InChIKey | KJRJGUXNBNXETQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |