C8H14ClN — CID 143745487
6-chloro-2-methyl-3,4-dihydropyridine;ethane (PubChem CID 143745487) has the molecular formula C8H14ClN and a molecular weight of 159.66 g/mol. Its IUPAC name is 6-chloro-2-methyl-3,4-dihydropyridine;ethane.
| Compound Name | 6-chloro-2-methyl-3,4-dihydropyridine;ethane |
|---|---|
| PubChem CID | 143745487 |
| Molecular Formula | C8H14ClN |
| Molecular Weight | 159.66 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 6-chloro-2-methyl-3,4-dihydropyridine;ethane |
| SMILES | CC.CC1=NC(Cl)=CCC1 |
| InChI | InChI=1S/C6H8ClN.C2H6/c1-5-3-2-4-6(7)8-5;1-2/h4H,2-3H2,1H3;1-2H3 |
| InChIKey | DIUZHXXSBVUFQS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.66 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|