About N,3-dimethylhexan-2-imine
N,3-dimethylhexan-2-imine (PubChem CID 123371156) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is N,3-dimethylhexan-2-imine.
Molecular Properties
| Compound Name | N,3-dimethylhexan-2-imine |
| PubChem CID | 123371156 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | N,3-dimethylhexan-2-imine |
| SMILES | CCCC(C)/C(C)=N/C |
| InChI | InChI=1S/C8H17N/c1-5-6-7(2)8(3)9-4/h7H,5-6H2,1-4H3/b9-8+ |
| InChIKey | YNFMETAIGLUEOA-CMDGGOBGSA-N |
| XLogP | 2.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethylhexan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethylhexan-2-imine?
The IUPAC name of N,3-dimethylhexan-2-imine (CID 123371156) is N,3-dimethylhexan-2-imine.
What is the SMILES notation for N,3-dimethylhexan-2-imine?
The canonical SMILES for N,3-dimethylhexan-2-imine is CCCC(C)/C(C)=N/C.
What is the InChIKey of N,3-dimethylhexan-2-imine?
The InChIKey is YNFMETAIGLUEOA-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H17N/c1-5-6-7(2)8(3)9-4/h7H,5-6H2,1-4H3/b9-8+.
What are the key properties of N,3-dimethylhexan-2-imine?
N,3-dimethylhexan-2-imine has a molecular weight of 127.23 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethylhexan-2-imine is sourced from PubChem (CID 123371156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).