C14H21N3O4 — CID 123372738
(2S)-2,5-diamino-4-[[(1S)-1-carboxy-2-phenylethyl]amino]pentanoic acid (PubChem CID 123372738) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is (2S)-2,5-diamino-4-[[(1S)-1-carboxy-2-phenylethyl]amino]pentanoic acid.
| Compound Name | (2S)-2,5-diamino-4-[[(1S)-1-carboxy-2-phenylethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 123372738 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | (2S)-2,5-diamino-4-[[(1S)-1-carboxy-2-phenylethyl]amino]pentanoic acid |
| SMILES | NCC(C[C@H](N)C(=O)O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H21N3O4/c15-8-10(7-11(16)13(18)19)17-12(14(20)21)6-9-4-2-1-3-5-9/h1-5,10-12,17H,6-8,15-16H2,(H,18,19)(H,20,21)/t10?,11-,12-/m0/s1 |
| InChIKey | JRXUOHOITXKDRG-RAMGSTBQSA-N |
| XLogP | -0.60 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |