C12H17ClFN3 — CID 123372995
2-[[(3-chloro-2-fluorophenyl)methylamino]methyl]pyrrolidin-3-amine (PubChem CID 123372995) has the molecular formula C12H17ClFN3 and a molecular weight of 257.74 g/mol. Its IUPAC name is 2-[[(3-chloro-2-fluorophenyl)methylamino]methyl]pyrrolidin-3-amine.
| Compound Name | 2-[[(3-chloro-2-fluorophenyl)methylamino]methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 123372995 |
| Molecular Formula | C12H17ClFN3 |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-[[(3-chloro-2-fluorophenyl)methylamino]methyl]pyrrolidin-3-amine |
| SMILES | NC1CCNC1CNCc1cccc(Cl)c1F |
| InChI | InChI=1S/C12H17ClFN3/c13-9-3-1-2-8(12(9)14)6-16-7-11-10(15)4-5-17-11/h1-3,10-11,16-17H,4-7,15H2 |
| InChIKey | ABOANCPZYSVEKD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |