C12H14ClF2N3O — CID 123841622
4-amino-N-[(3-chloro-2-fluorophenyl)methyl]-3-fluoropyrrolidine-2-carboxamide (PubChem CID 123841622) has the molecular formula C12H14ClF2N3O and a molecular weight of 289.71 g/mol. Its IUPAC name is 4-amino-N-[(3-chloro-2-fluorophenyl)methyl]-3-fluoropyrrolidine-2-carboxamide.
| Compound Name | 4-amino-N-[(3-chloro-2-fluorophenyl)methyl]-3-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123841622 |
| Molecular Formula | C12H14ClF2N3O |
| Molecular Weight | 289.71 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-amino-N-[(3-chloro-2-fluorophenyl)methyl]-3-fluoropyrrolidine-2-carboxamide |
| SMILES | NC1CNC(C(=O)NCc2cccc(Cl)c2F)C1F |
| InChI | InChI=1S/C12H14ClF2N3O/c13-7-3-1-2-6(9(7)14)4-18-12(19)11-10(15)8(16)5-17-11/h1-3,8,10-11,17H,4-5,16H2,(H,18,19) |
| InChIKey | KXGIHWKYPLMAOH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.71 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |