C13H13ClFIN2O — CID 126641393
(1R,3S,5S)-N-[(3-chloro-2-fluorophenyl)methyl]-1-iodo-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 126641393) has the molecular formula C13H13ClFIN2O and a molecular weight of 394.62 g/mol. Its IUPAC name is (1R,3S,5S)-N-[(3-chloro-2-fluorophenyl)methyl]-1-iodo-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5S)-N-[(3-chloro-2-fluorophenyl)methyl]-1-iodo-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 126641393 |
| Molecular Formula | C13H13ClFIN2O |
| Molecular Weight | 394.62 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | (1R,3S,5S)-N-[(3-chloro-2-fluorophenyl)methyl]-1-iodo-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1F)[C@@H]1C[C@H]2C[C@]2(I)N1 |
| InChI | InChI=1S/C13H13ClFIN2O/c14-9-3-1-2-7(11(9)15)6-17-12(19)10-4-8-5-13(8,16)18-10/h1-3,8,10,18H,4-6H2,(H,17,19)/t8-,10-,13-/m0/s1 |
| InChIKey | PRKROAVBESNCOP-FWDPORAESA-N |
| XLogP | 2.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|