C19H30S — CID 123373843
cyclohexa-2,4-dien-1-yl-hexa-1,5-dien-3-yl-hex-4-enyl-methyl-λ4-sulfane (PubChem CID 123373843) has the molecular formula C19H30S and a molecular weight of 290.52 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-yl-hexa-1,5-dien-3-yl-hex-4-enyl-methyl-λ4-sulfane.
| Compound Name | cyclohexa-2,4-dien-1-yl-hexa-1,5-dien-3-yl-hex-4-enyl-methyl-λ4-sulfane |
|---|---|
| PubChem CID | 123373843 |
| Molecular Formula | C19H30S |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | cyclohexa-2,4-dien-1-yl-hexa-1,5-dien-3-yl-hex-4-enyl-methyl-λ4-sulfane |
| SMILES | C=CCC(C=C)S(C)(CCCC=CC)C1C=CC=CC1 |
| InChI | InChI=1S/C19H30S/c1-5-8-9-13-17-20(4,18(7-3)14-6-2)19-15-11-10-12-16-19/h5-8,10-12,15,18-19H,2-3,9,13-14,16-17H2,1,4H3 |
| InChIKey | LWOYWHWGDRIVIA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|