C28H39N9O4SSi — CID 123374229
tert-butyl 4-[[6-[(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]pyrazole-1-carboxylate (PubChem CID 123374229) has the molecular formula C28H39N9O4SSi and a molecular weight of 625.83 g/mol. Its IUPAC name is tert-butyl 4-[[6-[(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-[(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 123374229 |
| Molecular Formula | C28H39N9O4SSi |
| Molecular Weight | 625.83 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | tert-butyl 4-[[6-[(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(Nc2cnc3ccc(N(COCC[Si](C)(C)C)c4nnc(N5CCOCC5)s4)nc3c2)cn1 |
| InChI | InChI=1S/C28H39N9O4SSi/c1-28(2,3)41-27(38)37-18-21(17-30-37)31-20-15-23-22(29-16-20)7-8-24(32-23)36(19-40-13-14-43(4,5)6)26-34-33-25(42-26)35-9-11-39-12-10-35/h7-8,15-18,31H,9-14,19H2,1-6H3 |
| InChIKey | ADKXNSCVOKNCFZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.83 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|