C21H21ClN7OS+ — CID 123375821
6-[4-(2-amino-6-chloro-3,5-dimethylpyrimidin-3-ium-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 123375821) has the molecular formula C21H21ClN7OS+ and a molecular weight of 454.97 g/mol. Its IUPAC name is 6-[4-(2-amino-6-chloro-3,5-dimethylpyrimidin-3-ium-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine.
| Compound Name | 6-[4-(2-amino-6-chloro-3,5-dimethylpyrimidin-3-ium-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine |
|---|---|
| PubChem CID | 123375821 |
| Molecular Formula | C21H21ClN7OS+ |
| Molecular Weight | 454.97 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 6-[4-(2-amino-6-chloro-3,5-dimethylpyrimidin-3-ium-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | Cc1c(Cl)nc(N)[n+](C)c1N1CCOc2ccc(-c3cnc4sc(N)nc4c3)cc2C1 |
| InChI | InChI=1S/C21H20ClN7OS/c1-11-17(22)27-20(23)28(2)19(11)29-5-6-30-16-4-3-12(7-14(16)10-29)13-8-15-18(25-9-13)31-21(24)26-15/h3-4,7-9,23H,5-6,10H2,1-2H3,(H2,24,26)/p+1 |
| InChIKey | DUYHCOHDYAHHOW-UHFFFAOYSA-O |
| XLogP | 3.10 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.97 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|