C24H29N7OS — CID 123648833
6-[4-[6-methyl-2-(methylamino)-5-propan-2-yl-2,5-dihydropyrimidin-4-yl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 123648833) has the molecular formula C24H29N7OS and a molecular weight of 463.61 g/mol. Its IUPAC name is 6-[4-[6-methyl-2-(methylamino)-5-propan-2-yl-2,5-dihydropyrimidin-4-yl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine.
| Compound Name | 6-[4-[6-methyl-2-(methylamino)-5-propan-2-yl-2,5-dihydropyrimidin-4-yl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine |
|---|---|
| PubChem CID | 123648833 |
| Molecular Formula | C24H29N7OS |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 6-[4-[6-methyl-2-(methylamino)-5-propan-2-yl-2,5-dihydropyrimidin-4-yl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | CNC1N=C(C)C(C(C)C)C(N2CCOc3ccc(-c4cnc5sc(N)nc5c4)cc3C2)=N1 |
| InChI | InChI=1S/C24H29N7OS/c1-13(2)20-14(3)28-24(26-4)30-21(20)31-7-8-32-19-6-5-15(9-17(19)12-31)16-10-18-22(27-11-16)33-23(25)29-18/h5-6,9-11,13,20,24,26H,7-8,12H2,1-4H3,(H2,25,29) |
| InChIKey | XLFGKRRBAPHYEI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |