C11H7Cl2N — CID 123376118
3,8-dichloro-4-methylidene-1-benzazepine (PubChem CID 123376118) has the molecular formula C11H7Cl2N and a molecular weight of 224.09 g/mol. Its IUPAC name is 3,8-dichloro-4-methylidene-1-benzazepine.
| Compound Name | 3,8-dichloro-4-methylidene-1-benzazepine |
|---|---|
| PubChem CID | 123376118 |
| Molecular Formula | C11H7Cl2N |
| Molecular Weight | 224.09 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 3,8-dichloro-4-methylidene-1-benzazepine |
| SMILES | C=C1C=c2ccc(Cl)cc2=NC=C1Cl |
| InChI | InChI=1S/C11H7Cl2N/c1-7-4-8-2-3-9(12)5-11(8)14-6-10(7)13/h2-6H,1H2 |
| InChIKey | TTZLOKJLXZCALZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.09 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |