C25H35NO6 — CID 123376451
(2,5-dihydroxypyrrol-1-yl) 2-[(17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]acetate (PubChem CID 123376451) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[(17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[(17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]acetate |
|---|---|
| PubChem CID | 123376451 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[(17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]acetate |
| SMILES | CC12CCC(OCC(=O)On3c(O)ccc3O)C=C1CCC1C2CCC2(C)C(O)CCC12 |
| InChI | InChI=1S/C25H35NO6/c1-24-11-9-16(31-14-23(30)32-26-21(28)7-8-22(26)29)13-15(24)3-4-17-18-5-6-20(27)25(18,2)12-10-19(17)24/h7-8,13,16-20,27-29H,3-6,9-12,14H2,1-2H3 |
| InChIKey | XGMPBBJVXHQTJB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|