C20H34ClNO3Si — CID 123376623
N-benzyl-N-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutan-2-yl]-2-chloropropanamide (PubChem CID 123376623) has the molecular formula C20H34ClNO3Si and a molecular weight of 400.04 g/mol. Its IUPAC name is N-benzyl-N-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutan-2-yl]-2-chloropropanamide.
| Compound Name | N-benzyl-N-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutan-2-yl]-2-chloropropanamide |
|---|---|
| PubChem CID | 123376623 |
| Molecular Formula | C20H34ClNO3Si |
| Molecular Weight | 400.04 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-benzyl-N-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutan-2-yl]-2-chloropropanamide |
| SMILES | CC(Cl)C(=O)N(Cc1ccccc1)C(CO)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34ClNO3Si/c1-15(21)19(24)22(13-17-11-9-8-10-12-17)18(14-23)16(2)25-26(6,7)20(3,4)5/h8-12,15-16,18,23H,13-14H2,1-7H3 |
| InChIKey | SGLQKJVSQVGCMF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.04 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|